C12H18FNO3S2 — CID 95984165
1-(4-fluorophenyl)-N-[(2S)-2-hydroxy-2-methyl-3-methylsulfanylpropyl]methanesulfonamide (PubChem CID 95984165) has the molecular formula C12H18FNO3S2 and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(2S)-2-hydroxy-2-methyl-3-methylsulfanylpropyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(2S)-2-hydroxy-2-methyl-3-methylsulfanylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 95984165 |
| Molecular Formula | C12H18FNO3S2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(2S)-2-hydroxy-2-methyl-3-methylsulfanylpropyl]methanesulfonamide |
| SMILES | CSC[C@@](C)(O)CNS(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H18FNO3S2/c1-12(15,9-18-2)8-14-19(16,17)7-10-3-5-11(13)6-4-10/h3-6,14-15H,7-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | GPCPEVWHQNXXCS-LBPRGKRZSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |