C12H18FNO3S2 — CID 122150626
3-fluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-methylbenzenesulfonamide (PubChem CID 122150626) has the molecular formula C12H18FNO3S2 and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122150626 |
| Molecular Formula | C12H18FNO3S2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-fluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-5-methylbenzenesulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)c1cc(C)cc(F)c1 |
| InChI | InChI=1S/C12H18FNO3S2/c1-9-4-10(13)6-11(5-9)19(16,17)14-7-12(2,15)8-18-3/h4-6,14-15H,7-8H2,1-3H3 |
| InChIKey | WYMZSQHCTJYRCX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |