C11H16N2O6S2 — CID 106245630
4-hydroxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-nitrobenzenesulfonamide (PubChem CID 106245630) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-hydroxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106245630 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-hydroxy-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3-nitrobenzenesulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H16N2O6S2/c1-11(15,7-20-2)6-12-21(18,19)8-3-4-10(14)9(5-8)13(16)17/h3-5,12,14-15H,6-7H2,1-2H3 |
| InChIKey | MUQREXHCSZFIBC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|