C12H18N2O6S — CID 106143830
4-hydroxy-N-(4-hydroxy-2,2-dimethylbutyl)-3-nitrobenzenesulfonamide (PubChem CID 106143830) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 4-hydroxy-N-(4-hydroxy-2,2-dimethylbutyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4-hydroxy-2,2-dimethylbutyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106143830 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-hydroxy-N-(4-hydroxy-2,2-dimethylbutyl)-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(CCO)CNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N2O6S/c1-12(2,5-6-15)8-13-21(19,20)9-3-4-11(16)10(7-9)14(17)18/h3-4,7,13,15-16H,5-6,8H2,1-2H3 |
| InChIKey | RBWKUSXRACACCR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|