C10H15ClN2O5S2 — CID 106143626
5-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 106143626) has the molecular formula C10H15ClN2O5S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106143626 |
| Molecular Formula | C10H15ClN2O5S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 5-chloro-N-(4-hydroxy-2,2-dimethylbutyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | CC(C)(CCO)CNS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2O5S2/c1-10(2,3-4-14)6-12-20(17,18)8-5-7(13(15)16)9(11)19-8/h5,12,14H,3-4,6H2,1-2H3 |
| InChIKey | VRZCLGAGRWNYOG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|