C10H13ClN2O6S2 — CID 80735306
2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-2-methylpentanoic acid (PubChem CID 80735306) has the molecular formula C10H13ClN2O6S2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-2-methylpentanoic acid.
| Compound Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 80735306 |
| Molecular Formula | C10H13ClN2O6S2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1)C(=O)O |
| InChI | InChI=1S/C10H13ClN2O6S2/c1-3-4-10(2,9(14)15)12-21(18,19)7-5-6(13(16)17)8(11)20-7/h5,12H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | CGWZOCGWZUTBOR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|