C8H9ClN2O7S2 — CID 107824052
(2S)-2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-4-hydroxybutanoic acid (PubChem CID 107824052) has the molecular formula C8H9ClN2O7S2 and a molecular weight of 344.75 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107824052 |
| Molecular Formula | C8H9ClN2O7S2 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | (2S)-2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(O)[C@H](CCO)NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C8H9ClN2O7S2/c9-7-5(11(15)16)3-6(19-7)20(17,18)10-4(1-2-12)8(13)14/h3-4,10,12H,1-2H2,(H,13,14)/t4-/m0/s1 |
| InChIKey | BDOWFSMOKSJZAK-BYPYZUCNSA-N |
| XLogP | 0.42 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|