C7H10ClN3O4S2 — CID 80742339
N-(1-aminopropan-2-yl)-5-chloro-4-nitrothiophene-2-sulfonamide (PubChem CID 80742339) has the molecular formula C7H10ClN3O4S2 and a molecular weight of 299.76 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-5-chloro-4-nitrothiophene-2-sulfonamide.
| Compound Name | N-(1-aminopropan-2-yl)-5-chloro-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80742339 |
| Molecular Formula | C7H10ClN3O4S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | N-(1-aminopropan-2-yl)-5-chloro-4-nitrothiophene-2-sulfonamide |
| SMILES | CC(CN)NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O4S2/c1-4(3-9)10-17(14,15)6-2-5(11(12)13)7(8)16-6/h2,4,10H,3,9H2,1H3 |
| InChIKey | ORKYWSKVMHJSDZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|