C10H14ClN3O5S2 — CID 112729900
2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-N-propylpropanamide (PubChem CID 112729900) has the molecular formula C10H14ClN3O5S2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 112729900 |
| Molecular Formula | C10H14ClN3O5S2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 2-[(5-chloro-4-nitrothiophen-2-yl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C10H14ClN3O5S2/c1-3-4-12-10(15)6(2)13-21(18,19)8-5-7(14(16)17)9(11)20-8/h5-6,13H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | DLVQCIUZEFMDBR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|