C9H13ClN2O5S2 — CID 80742459
5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80742459) has the molecular formula C9H13ClN2O5S2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80742459 |
| Molecular Formula | C9H13ClN2O5S2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 5-chloro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-nitrothiophene-2-sulfonamide |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cc([N+](=O)[O-])c(Cl)s1 |
| InChI | InChI=1S/C9H13ClN2O5S2/c1-5(2)6(4-13)11-19(16,17)8-3-7(12(14)15)9(10)18-8/h3,5-6,11,13H,4H2,1-2H3/t6-/m1/s1 |
| InChIKey | RHNVHFJKIPEJRX-ZCFIWIBFSA-N |
| XLogP | 1.60 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|