C8H9N3O6S — CID 43217851
2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]acetamide (PubChem CID 43217851) has the molecular formula C8H9N3O6S and a molecular weight of 275.24 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 43217851 |
| Molecular Formula | C8H9N3O6S |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9N3O6S/c9-8(13)4-10-18(16,17)5-1-2-7(12)6(3-5)11(14)15/h1-3,10,12H,4H2,(H2,9,13) |
| InChIKey | HHJUWRFFCFTKPH-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|