C13H19NO3S2 — CID 90523087
(E)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-phenylethenesulfonamide (PubChem CID 90523087) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (E)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-phenylethenesulfonamide.
| Compound Name | (E)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 90523087 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (E)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-2-phenylethenesulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H19NO3S2/c1-13(15,11-18-2)10-14-19(16,17)9-8-12-6-4-3-5-7-12/h3-9,14-15H,10-11H2,1-2H3/b9-8+ |
| InChIKey | GPACUBVBRXBIIY-CMDGGOBGSA-N |
| XLogP | 1.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |