C10H10NO4S- — CID 4137274
2-(2-phenylethenylsulfonylamino)acetate (PubChem CID 4137274) has the molecular formula C10H10NO4S- and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2-phenylethenylsulfonylamino)acetate.
| Compound Name | 2-(2-phenylethenylsulfonylamino)acetate |
|---|---|
| PubChem CID | 4137274 |
| Molecular Formula | C10H10NO4S- |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-(2-phenylethenylsulfonylamino)acetate |
| SMILES | O=C([O-])CNS(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO4S/c12-10(13)8-11-16(14,15)7-6-9-4-2-1-3-5-9/h1-7,11H,8H2,(H,12,13)/p-1 |
| InChIKey | BENSSPRDYYRKBA-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |