About propanedioate;(E)-stilbene
propanedioate;(E)-stilbene (PubChem CID 19773481) has the molecular formula C17H14O4-2
and a molecular weight of 282.30 g/mol. Its IUPAC name is propanedioate;(E)-stilbene.
Molecular Properties
| Compound Name | propanedioate;(E)-stilbene |
| PubChem CID | 19773481 |
| Molecular Formula | C17H14O4-2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | propanedioate;(E)-stilbene |
| SMILES | C(=C/c1ccccc1)\c1ccccc1.O=C([O-])CC(=O)[O-] |
| InChI | InChI=1S/C14H12.C3H4O4/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;4-2(5)1-3(6)7/h1-12H;1H2,(H,4,5)(H,6,7)/p-2/b12-11+; |
| InChIKey | BSPLUVOBJKMOIV-CALJPSDSSA-L |
| XLogP | 0.73 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze propanedioate;(E)-stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanedioate;(E)-stilbene?
The IUPAC name of propanedioate;(E)-stilbene (CID 19773481) is propanedioate;(E)-stilbene.
What is the SMILES notation for propanedioate;(E)-stilbene?
The canonical SMILES for propanedioate;(E)-stilbene is C(=C/c1ccccc1)\c1ccccc1.O=C([O-])CC(=O)[O-].
What is the InChIKey of propanedioate;(E)-stilbene?
The InChIKey is BSPLUVOBJKMOIV-CALJPSDSSA-L. The full InChI is InChI=1S/C14H12.C3H4O4/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;4-2(5)1-3(6)7/h1-12H;1H2,(H,4,5)(H,6,7)/p-2/b12-11+;.
What are the key properties of propanedioate;(E)-stilbene?
propanedioate;(E)-stilbene has a molecular weight of 282.30 g/mol, XLogP of 0.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanedioate;(E)-stilbene is sourced from PubChem (CID 19773481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).