About (E)-4-phenylbut-3-enoate
(E)-4-phenylbut-3-enoate (PubChem CID 176539438) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is (E)-4-phenylbut-3-enoate.
Molecular Properties
| Compound Name | (E)-4-phenylbut-3-enoate |
| PubChem CID | 176539438 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | (E)-4-phenylbut-3-enoate |
| SMILES | O=C([O-])[CH+]/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H8O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+ |
| InChIKey | JVEMEPSGBPRQIH-QPJJXVBHSA-N |
| XLogP | 0.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-phenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-phenylbut-3-enoate?
The IUPAC name of (E)-4-phenylbut-3-enoate (CID 176539438) is (E)-4-phenylbut-3-enoate.
What is the SMILES notation for (E)-4-phenylbut-3-enoate?
The canonical SMILES for (E)-4-phenylbut-3-enoate is O=C([O-])[CH+]/C=C/c1ccccc1.
What is the InChIKey of (E)-4-phenylbut-3-enoate?
The InChIKey is JVEMEPSGBPRQIH-QPJJXVBHSA-N. The full InChI is InChI=1S/C10H8O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-8H/b7-4+.
What are the key properties of (E)-4-phenylbut-3-enoate?
(E)-4-phenylbut-3-enoate has a molecular weight of 160.17 g/mol, XLogP of 0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-phenylbut-3-enoate is sourced from PubChem (CID 176539438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).