C12H14N2O5S — CID 6235486
2-[[2-[[(E)-2-phenylethenyl]sulfonylamino]acetyl]amino]acetic acid (PubChem CID 6235486) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[[2-[[(E)-2-phenylethenyl]sulfonylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(E)-2-phenylethenyl]sulfonylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 6235486 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[[2-[[(E)-2-phenylethenyl]sulfonylamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H14N2O5S/c15-11(13-9-12(16)17)8-14-20(18,19)7-6-10-4-2-1-3-5-10/h1-7,14H,8-9H2,(H,13,15)(H,16,17)/b7-6+ |
| InChIKey | RNZRVTZGMJXIGG-VOTSOKGWSA-N |
| XLogP | -0.22 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |