C13H17NO4S — CID 35522147
propyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 35522147) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is propyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | propyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 35522147 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | propyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CCCOC(=O)CNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H17NO4S/c1-2-9-18-13(15)11-14-19(16,17)10-8-12-6-4-3-5-7-12/h3-8,10,14H,2,9,11H2,1H3/b10-8+ |
| InChIKey | VNUFPGJCBFZQIL-CSKARUKUSA-N |
| XLogP | 1.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |