C18H24N2O5S — CID 7826987
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 7826987) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7826987 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CC1CCN(C(=O)COC(=O)CNS(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N2O5S/c1-15-7-10-20(11-8-15)17(21)14-25-18(22)13-19-26(23,24)12-9-16-5-3-2-4-6-16/h2-6,9,12,15,19H,7-8,10-11,13-14H2,1H3/b12-9+ |
| InChIKey | ZXSIESRRQVNHLC-FMIVXFBMSA-N |
| XLogP | 1.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |