C19H19NO5S — CID 71954263
phenacyl 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate (PubChem CID 71954263) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is phenacyl 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate.
| Compound Name | phenacyl 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate |
|---|---|
| PubChem CID | 71954263 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | phenacyl 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate |
| SMILES | Cc1ccc(C=CS(=O)(=O)NCC(=O)OCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-15-7-9-16(10-8-15)11-12-26(23,24)20-13-19(22)25-14-18(21)17-5-3-2-4-6-17/h2-12,20H,13-14H2,1H3 |
| InChIKey | PKQNCGHVUWKRQG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |