C20H20ClN3O6S — CID 71954285
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate (PubChem CID 71954285) has the molecular formula C20H20ClN3O6S and a molecular weight of 465.92 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate |
|---|---|
| PubChem CID | 71954285 |
| Molecular Formula | C20H20ClN3O6S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-[2-(4-methylphenyl)ethenylsulfonylamino]acetate |
| SMILES | Cc1ccc(C=CS(=O)(=O)NCC(=O)OCC(=O)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O6S/c1-14-2-4-15(5-3-14)10-11-31(28,29)22-12-19(26)30-13-18(25)23-24-20(27)16-6-8-17(21)9-7-16/h2-11,22H,12-13H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | IHESNOPNCCROGI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|