C12H14ClNO4S — CID 54921365
ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]acetate (PubChem CID 54921365) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 54921365 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | ethyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO4S/c1-2-18-12(15)9-14-19(16,17)8-7-10-3-5-11(13)6-4-10/h3-8,14H,2,9H2,1H3/b8-7+ |
| InChIKey | KTRCHBWPDRPYIX-BQYQJAHWSA-N |
| XLogP | 1.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |