C12H13ClN2O5S — CID 22750871
methyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylcarbamoylamino]acetate (PubChem CID 22750871) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is methyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylcarbamoylamino]acetate.
| Compound Name | methyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 22750871 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | methyl 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylcarbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)NS(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O5S/c1-20-11(16)8-14-12(17)15-21(18,19)7-6-9-2-4-10(13)5-3-9/h2-7H,8H2,1H3,(H2,14,15,17)/b7-6+ |
| InChIKey | SDHMIFMTAAEJGY-VOTSOKGWSA-N |
| XLogP | 1.11 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |