C14H17ClN2O4S — CID 22750915
N-[(E)-2-(4-chlorophenyl)prop-1-enyl]sulfonylmorpholine-4-carboxamide (PubChem CID 22750915) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is N-[(E)-2-(4-chlorophenyl)prop-1-enyl]sulfonylmorpholine-4-carboxamide.
| Compound Name | N-[(E)-2-(4-chlorophenyl)prop-1-enyl]sulfonylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 22750915 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[(E)-2-(4-chlorophenyl)prop-1-enyl]sulfonylmorpholine-4-carboxamide |
| SMILES | C/C(=C\S(=O)(=O)NC(=O)N1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O4S/c1-11(12-2-4-13(15)5-3-12)10-22(19,20)16-14(18)17-6-8-21-9-7-17/h2-5,10H,6-9H2,1H3,(H,16,18)/b11-10+ |
| InChIKey | ZKRJYEQUSAFPRQ-ZHACJKMWSA-N |
| XLogP | 2.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |