C14H16ClNO4S — CID 27278992
2-chloroprop-2-enyl 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate (PubChem CID 27278992) has the molecular formula C14H16ClNO4S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate.
| Compound Name | 2-chloroprop-2-enyl 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 27278992 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate |
| SMILES | C=C(Cl)COC(=O)CNS(=O)(=O)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16ClNO4S/c1-11-3-5-13(6-4-11)7-8-21(18,19)16-9-14(17)20-10-12(2)15/h3-8,16H,2,9-10H2,1H3/b8-7+ |
| InChIKey | STLVOXGBQVVILG-BQYQJAHWSA-N |
| XLogP | 2.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |