C17H22N2O6S — CID 7397934
(2-morpholin-4-yl-2-oxoethyl) 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate (PubChem CID 7397934) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7397934 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-[[(E)-2-(4-methylphenyl)ethenyl]sulfonylamino]acetate |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)NCC(=O)OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H22N2O6S/c1-14-2-4-15(5-3-14)6-11-26(22,23)18-12-17(21)25-13-16(20)19-7-9-24-10-8-19/h2-6,11,18H,7-10,12-13H2,1H3/b11-6+ |
| InChIKey | XHVSRRJLAMRGPF-IZZDOVSWSA-N |
| XLogP | 0.29 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |