C15H18N2O7S — CID 8892232
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 8892232) has the molecular formula C15H18N2O7S and a molecular weight of 370.38 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 8892232 |
| Molecular Formula | C15H18N2O7S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18N2O7S/c1-2-23-15(20)17-13(18)11-24-14(19)10-16-25(21,22)9-8-12-6-4-3-5-7-12/h3-9,16H,2,10-11H2,1H3,(H,17,18,20)/b9-8+ |
| InChIKey | XSJLOMWPSISKJV-CMDGGOBGSA-N |
| XLogP | 0.39 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |