C20H21NO5S — CID 7826850
[2-(4-ethylphenyl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 7826850) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7826850 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CCc1ccc(C(=O)COC(=O)CNS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO5S/c1-2-16-8-10-18(11-9-16)19(22)15-26-20(23)14-21-27(24,25)13-12-17-6-4-3-5-7-17/h3-13,21H,2,14-15H2,1H3/b13-12+ |
| InChIKey | ADBOENWNYDKTQA-OUKQBFOZSA-N |
| XLogP | 2.57 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |