C19H18FNO5S — CID 8676077
[2-(3-fluorophenyl)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate (PubChem CID 8676077) has the molecular formula C19H18FNO5S and a molecular weight of 391.42 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8676077 |
| Molecular Formula | C19H18FNO5S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)/C=C/c1ccccc1)OCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H18FNO5S/c20-17-8-4-7-16(13-17)18(22)14-26-19(23)9-11-21-27(24,25)12-10-15-5-2-1-3-6-15/h1-8,10,12-13,21H,9,11,14H2/b12-10+ |
| InChIKey | MVFHHWZJJBSXQP-ZRDIBKRKSA-N |
| XLogP | 2.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |