C20H23NO5S — CID 7827992
2-(2-methylphenoxy)ethyl 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate (PubChem CID 7827992) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate.
| Compound Name | 2-(2-methylphenoxy)ethyl 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7827992 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl 3-[[(E)-2-phenylethenyl]sulfonylamino]propanoate |
| SMILES | Cc1ccccc1OCCOC(=O)CCNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H23NO5S/c1-17-7-5-6-10-19(17)25-14-15-26-20(22)11-13-21-27(23,24)16-12-18-8-3-2-4-9-18/h2-10,12,16,21H,11,13-15H2,1H3/b16-12+ |
| InChIKey | OCIJIWVPVIQVMQ-FOWTUZBSSA-N |
| XLogP | 2.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|