C21H23NO4S — CID 70513692
ethyl (E)-3-[4-[2-(2-phenylethenylsulfonylamino)ethyl]phenyl]prop-2-enoate (PubChem CID 70513692) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-(2-phenylethenylsulfonylamino)ethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[2-(2-phenylethenylsulfonylamino)ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70513692 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl (E)-3-[4-[2-(2-phenylethenylsulfonylamino)ethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(CCNS(=O)(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-26-21(23)13-12-19-8-10-20(11-9-19)14-16-22-27(24,25)17-15-18-6-4-3-5-7-18/h3-13,15,17,22H,2,14,16H2,1H3/b13-12+,17-15? |
| InChIKey | HNWOGEHJKFEZRY-YQIPHYSDSA-N |
| XLogP | 3.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|