C19H18ClNO4S — CID 54514129
3-[4-[2-[2-(4-chlorophenyl)ethenylsulfonylamino]ethyl]phenyl]prop-2-enoic acid (PubChem CID 54514129) has the molecular formula C19H18ClNO4S and a molecular weight of 391.88 g/mol. Its IUPAC name is 3-[4-[2-[2-(4-chlorophenyl)ethenylsulfonylamino]ethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-[2-(4-chlorophenyl)ethenylsulfonylamino]ethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54514129 |
| Molecular Formula | C19H18ClNO4S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 3-[4-[2-[2-(4-chlorophenyl)ethenylsulfonylamino]ethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CCNS(=O)(=O)C=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClNO4S/c20-18-8-5-17(6-9-18)12-14-26(24,25)21-13-11-16-3-1-15(2-4-16)7-10-19(22)23/h1-10,12,14,21H,11,13H2,(H,22,23) |
| InChIKey | YLEZNISSGDLSNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|