C16H15Cl2NO2S — CID 9301836
(E)-2-(4-chlorophenyl)-N-[2-(3-chlorophenyl)ethyl]ethenesulfonamide (PubChem CID 9301836) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-N-[2-(3-chlorophenyl)ethyl]ethenesulfonamide.
| Compound Name | (E)-2-(4-chlorophenyl)-N-[2-(3-chlorophenyl)ethyl]ethenesulfonamide |
|---|---|
| PubChem CID | 9301836 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-N-[2-(3-chlorophenyl)ethyl]ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccc(Cl)cc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO2S/c17-15-6-4-13(5-7-15)9-11-22(20,21)19-10-8-14-2-1-3-16(18)12-14/h1-7,9,11-12,19H,8,10H2/b11-9+ |
| InChIKey | HIJOWGDWQOTXGG-PKNBQFBNSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |