C20H23NO5S — CID 55321942
2-(3-ethylphenoxy)ethyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 55321942) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55321942 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CCc1cccc(OCCOC(=O)CNS(=O)(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-2-17-9-6-10-19(15-17)25-12-13-26-20(22)16-21-27(23,24)14-11-18-7-4-3-5-8-18/h3-11,14-15,21H,2,12-13,16H2,1H3/b14-11+ |
| InChIKey | IQNQGVPYTGNFOI-SDNWHVSQSA-N |
| XLogP | 2.76 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|