C21H23NO5S — CID 7826898
[(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 7826898) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7826898 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | CCc1ccc(C(=O)[C@H](C)OC(=O)CNS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-3-17-9-11-19(12-10-17)21(24)16(2)27-20(23)15-22-28(25,26)14-13-18-7-5-4-6-8-18/h4-14,16,22H,3,15H2,1-2H3/b14-13+/t16-/m0/s1 |
| InChIKey | UMAWLHLPPBUJPX-VUSFMPOISA-N |
| XLogP | 2.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |