C20H23NO5S — CID 7978357
phenacyl 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate (PubChem CID 7978357) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is phenacyl 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate.
| Compound Name | phenacyl 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7978357 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | phenacyl 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)OCC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-14-11-15(2)20(16(3)12-14)27(24,25)21-10-9-19(23)26-13-18(22)17-7-5-4-6-8-17/h4-8,11-12,21H,9-10,13H2,1-3H3 |
| InChIKey | VXZDQTRRXAVFQV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |