C20H22FNO5S — CID 8676797
[2-(3-fluorophenyl)-2-oxoethyl] 4-[(3,4-dimethylphenyl)sulfonylamino]butanoate (PubChem CID 8676797) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 4-[(3,4-dimethylphenyl)sulfonylamino]butanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 4-[(3,4-dimethylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 8676797 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 4-[(3,4-dimethylphenyl)sulfonylamino]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(=O)OCC(=O)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C20H22FNO5S/c1-14-8-9-18(11-15(14)2)28(25,26)22-10-4-7-20(24)27-13-19(23)16-5-3-6-17(21)12-16/h3,5-6,8-9,11-12,22H,4,7,10,13H2,1-2H3 |
| InChIKey | GNPUJOYOWYPTPT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|