C17H15F2NO5S — CID 8676964
[2-(3-fluorophenyl)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 8676964) has the molecular formula C17H15F2NO5S and a molecular weight of 383.37 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 8676964 |
| Molecular Formula | C17H15F2NO5S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCC(=O)c1cccc(F)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2NO5S/c1-20(26(23,24)15-7-5-13(18)6-8-15)10-17(22)25-11-16(21)12-3-2-4-14(19)9-12/h2-9H,10-11H2,1H3 |
| InChIKey | GWAIKIJPMGVWRI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |