C15H21FN2O5S — CID 7848697
[2-(2-methylpropylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 7848697) has the molecular formula C15H21FN2O5S and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7848697 |
| Molecular Formula | C15H21FN2O5S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(C)CNC(=O)COC(=O)CN(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O5S/c1-11(2)8-17-14(19)10-23-15(20)9-18(3)24(21,22)13-6-4-12(16)5-7-13/h4-7,11H,8-10H2,1-3H3,(H,17,19) |
| InChIKey | NSMMFRRJNXOTCC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |