C18H16FN3O5S — CID 7848962
[2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate (PubChem CID 7848962) has the molecular formula C18H16FN3O5S and a molecular weight of 405.41 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7848962 |
| Molecular Formula | C18H16FN3O5S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCC(=O)Nc1cccc(C#N)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3O5S/c1-22(28(25,26)16-7-5-14(19)6-8-16)11-18(24)27-12-17(23)21-15-4-2-3-13(9-15)10-20/h2-9H,11-12H2,1H3,(H,21,23) |
| InChIKey | IDMKFUFXCKNVQJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |