C19H21FN2O5S — CID 7169612
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 7169612) has the molecular formula C19H21FN2O5S and a molecular weight of 408.45 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7169612 |
| Molecular Formula | C19H21FN2O5S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)OCC(=O)Nc2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN2O5S/c1-13-4-8-16(9-5-13)28(25,26)22(3)11-19(24)27-12-18(23)21-15-7-6-14(2)17(20)10-15/h4-10H,11-12H2,1-3H3,(H,21,23) |
| InChIKey | FWBHBRYCAPBLBG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |