C18H21N3O7S2 — CID 40782377
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 40782377) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 40782377 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)OCC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O7S2/c1-13-3-7-16(8-4-13)30(26,27)21(2)11-18(23)28-12-17(22)20-14-5-9-15(10-6-14)29(19,24)25/h3-10H,11-12H2,1-2H3,(H,20,22)(H2,19,24,25) |
| InChIKey | GMJDXIVHKJHLAD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |