C18H18ClNO5S — CID 2339654
[2-(4-methylphenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate (PubChem CID 2339654) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 2339654 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate |
| SMILES | Cc1ccc(C(=O)COC(=O)CN(C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H18ClNO5S/c1-13-3-5-14(6-4-13)17(21)12-25-18(22)11-20(2)26(23,24)16-9-7-15(19)8-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | KHFQFOHQYGSURB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |