C18H20ClNO5S — CID 46617678
(5-chloro-2-methoxyphenyl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 46617678) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 46617678 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(Cl)cc1COC(=O)CN(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20ClNO5S/c1-13-4-7-16(8-5-13)26(22,23)20(2)11-18(21)25-12-14-10-15(19)6-9-17(14)24-3/h4-10H,11-12H2,1-3H3 |
| InChIKey | UGYNWEJRSKIBMT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |