C11H14ClNO5S — CID 43422565
methyl 2-[(4-chloro-2-methoxyphenyl)sulfonyl-methylamino]acetate (PubChem CID 43422565) has the molecular formula C11H14ClNO5S and a molecular weight of 307.76 g/mol. Its IUPAC name is methyl 2-[(4-chloro-2-methoxyphenyl)sulfonyl-methylamino]acetate.
| Compound Name | methyl 2-[(4-chloro-2-methoxyphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 43422565 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | methyl 2-[(4-chloro-2-methoxyphenyl)sulfonyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)S(=O)(=O)c1ccc(Cl)cc1OC |
| InChI | InChI=1S/C11H14ClNO5S/c1-13(7-11(14)18-3)19(15,16)10-5-4-8(12)6-9(10)17-2/h4-6H,7H2,1-3H3 |
| InChIKey | JLOAANRBPMAMNQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |