C20H22N2O7S — CID 40782403
methyl 4-[[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]amino]benzoate (PubChem CID 40782403) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is methyl 4-[[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 40782403 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | methyl 4-[[2-[2-[methyl-(4-methylphenyl)sulfonylamino]acetyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)CN(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O7S/c1-14-4-10-17(11-5-14)30(26,27)22(2)12-19(24)29-13-18(23)21-16-8-6-15(7-9-16)20(25)28-3/h4-11H,12-13H2,1-3H3,(H,21,23) |
| InChIKey | WYVBPVLSKLURFY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |