C21H21N3O6S — CID 24669701
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 24669701) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 24669701 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCC(=O)Nc2ccc(CC#N)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O6S/c1-15(25)17-5-9-19(10-6-17)31(28,29)24(2)13-21(27)30-14-20(26)23-18-7-3-16(4-8-18)11-12-22/h3-10H,11,13-14H2,1-2H3,(H,23,26) |
| InChIKey | MOSHIVGZDCNHCK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |