C18H18N2O8S — CID 55546945
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 55546945) has the molecular formula C18H18N2O8S and a molecular weight of 422.42 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 55546945 |
| Molecular Formula | C18H18N2O8S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCC(=O)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H18N2O8S/c1-12(21)13-5-7-14(8-6-13)29(25,26)20(2)10-17(23)28-11-16(22)19-18(24)15-4-3-9-27-15/h3-9H,10-11H2,1-2H3,(H,19,22,24) |
| InChIKey | IBICQAYZGKXQTQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |