C19H21NO5S — CID 55539189
2-phenylethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 55539189) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-phenylethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | 2-phenylethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 55539189 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-phenylethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-15(21)17-8-10-18(11-9-17)26(23,24)20(2)14-19(22)25-13-12-16-6-4-3-5-7-16/h3-11H,12-14H2,1-2H3 |
| InChIKey | DURIIWSGBBVENM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |