C19H18F3NO5S — CID 24669709
[4-(trifluoromethyl)phenyl]methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 24669709) has the molecular formula C19H18F3NO5S and a molecular weight of 429.42 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 24669709 |
| Molecular Formula | C19H18F3NO5S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3NO5S/c1-13(24)15-5-9-17(10-6-15)29(26,27)23(2)11-18(25)28-12-14-3-7-16(8-4-14)19(20,21)22/h3-10H,11-12H2,1-2H3 |
| InChIKey | DEUGLANDIUROQL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |