C13H17NO5S — CID 60731070
ethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 60731070) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
| Compound Name | ethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 60731070 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | ethyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C13H17NO5S/c1-4-19-13(16)9-14(3)20(17,18)12-7-5-11(6-8-12)10(2)15/h5-8H,4,9H2,1-3H3 |
| InChIKey | DAUDCJBUJQOIOZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |